OwlCyberSecurity - MANAGER
Edit File: UBDiagnostics.php
<?php class UBDiagnostics { const SUPPORTED_PHP_VERSION = '5.3'; const SUPPORTED_WP_VERSION = '4.0'; public static function checks($domain, $domain_info) { return array_merge(self::domain_checks($domain, $domain_info), self::system_checks()); } public static function domain_checks($domain, $domain_info) { $dynamic_config = get_option(UBConfig::UB_DYNAMIC_CONFIG_CACHE_KEY, array()); $uuid = get_option(UBConfig::UB_DOMAIN_UUID_KEY, ''); $result = array( 'Domain is Authorized' => UBConfig::is_authorized_domain($domain), 'Can Fetch Page Listing' => UBDiagnostics::last_status_success($domain_info) ); if (UBConfig::has_authorized()) { $result['Domain UUID'] = $uuid !== ''; } if (isset($dynamic_config['last_status'])) { $result['Dynamic Config Retrieval'] = $dynamic_config['last_status'] !== 'FAILURE'; } return $result; } public static function system_checks() { return array( 'Curl Support' => self::is_curl_installed(), 'XML Support' => self::is_xml_installed(), 'Permalink Structure' => get_option('permalink_structure', '') !== '', 'Supported PHP Version' => version_compare( phpversion(), UBDiagnostics::SUPPORTED_PHP_VERSION, '>=' ), 'Supported Wordpress Version' => version_compare( UBDiagnostics::wordpress_version(), UBDiagnostics::SUPPORTED_WP_VERSION, '>=' ), 'SNI Support' => self::has_sni(), ); } public static function has_sni() { return defined('OPENSSL_TLSEXT_SERVER_NAME') && OPENSSL_TLSEXT_SERVER_NAME; } public static function is_curl_installed() { return function_exists('curl_init'); } public static function is_xml_installed() { return function_exists('simplexml_load_string'); } public static function should_show_warning($domain, $domain_info) { $domain_issue = in_array(false, self::domain_checks($domain, $domain_info)); $system_issue = in_array(false, self::system_checks()); if (UBConfig::has_authorized()) { return $domain_issue || $system_issue; } else { return $system_issue; } } /** * Format a variable as condensed human-readable output * Example: non-assoc arrays are output as [foo, bar] and assoc looks like * [ * foo: 'bar' * baz: NULL * ] * @param mixed $var * @param int $level * @return string */ private static function pp($var, $level = 1) { $str = ''; if (is_array($var)) { $simple = empty($var) ? true : array_keys($var) === range(0, count($var) -1); $str .= '['; if ($simple) { $str .= implode(', ', $var); } else { foreach ($var as $key => $value) { $str .= "\n" . str_repeat(' ', $level) . "$key: " . self::pp($value, $level + 1); } } $str .= ']'; } else { $str = var_export($var, true); } return $str; } public static function details($domain, $domain_info) { return array( 'PHP Version' => phpversion(), 'WordPress Version' => UBDiagnostics::wordpress_version(), 'Unbounce Plugin Version' => '1.1.2', 'Checks' => self::pp(UBDiagnostics::checks($domain, $domain_info)), 'Options' => self::pp(UBDiagnostics::ub_options()), 'Permalink Structure' => get_option('permalink_structure', ''), 'Domain' => $domain, 'Domain Authorized' => self::pp(UBConfig::is_authorized_domain($domain)), 'Has Authorized' => self::pp(UBConfig::has_authorized()), 'Active Plugins' => self::pp(get_option('active_plugins')), 'Plugin Details' => self::pp(get_plugins()), 'Curl Version' => self::pp(UBDiagnostics::curl_version()), 'SNI Support' => self::has_sni(), 'Configuration Options' => self::pp(self::phpConfig()), 'Extensions' => self::pp(get_loaded_extensions()), 'Operating System' => php_uname(), ); } private static function phpConfig() { return ini_get_all(null, false); } private static function ub_options() { $ub_options = array(); array_walk(UBConfig::ub_option_defaults(), function ($v, $k) use (&$ub_options) { $ub_options[$k] = get_option($k, $v); }); return $ub_options; } private static function curl_version() { if (function_exists('curl_version')) { return curl_version(); } else { return 'N/A'; } } public static function wordpress_version() { global $wp_version; include(ABSPATH . WPINC . '/version.php'); return $wp_version; } private static function last_status_success($domain_info) { $last_status = UBUtil::array_fetch($domain_info, 'last_status'); return $last_status !== null && $last_status !== 'FAILURE'; } /** * Perform a sitemap request with default parameters to test communication with unbounce * @return array */ public static function testSiteMapRequest() { $res = UBConfig::fetch_proxyable_url_set(UBConfig::domain(), null, UBConfig::page_server_domain()); if (!is_array($res) || !isset($res[0])) { return array( 'status' => 'ERROR', 'result' => var_export($res, true), ); } return $res[0]; } /** * Retrieve environment details relevant at plugin activation time * @return array */ public static function installationDetails() { return array( 'php' => phpversion(), 'wordpress' => UBDiagnostics::wordpress_version(), 'plugin_version' => '1.1.2', 'curl_installed' => self::is_curl_installed(), 'xml_installed' => self::is_xml_installed(), 'sni_support' => self::has_sni(), 'permalink_structure' => get_option('permalink_structure'), 'domain' => UBConfig::domain(), 'active_plugins' => get_option('active_plugins'), 'curl_version' => UBDiagnostics::curl_version(), 'php_config' => UBUtil::array_select_by_key( self::phpConfig(), array( 'allow_url_fopen', 'cgi.discard_path', 'cgi.fix_pathinfo', 'curl.cainfo', 'default_charset', 'default_socket_timeout', 'disable_functions', 'display_errors', 'error_reporting', 'enable_post_data_reading', 'file_uploads', 'implicit_flush', 'memory_limit', 'max_execution_time', 'max_input_time', 'opcache.enable', 'openssl.cafile', 'openssl.capath', 'output_buffering', 'output_encoding', 'output_handler', 'post_max_size', 'short_open_tag', 'upload_max_filesize', ) ), 'php_extensions' => get_loaded_extensions(), 'os' => php_uname(), ); } }